EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33ClN2O3 |
| Net Charge | 0 |
| Average Mass | 420.981 |
| Monoisotopic Mass | 420.21797 |
| SMILES | CC(C)C1=CN(CCC(=O)O)C(=O)N[C@@]1(C)c1ccc(CCC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C23H33ClN2O3/c1-15(2)18-14-26(12-10-20(27)28)21(29)25-23(18,6)17-8-7-16(19(24)13-17)9-11-22(3,4)5/h7-8,13-15H,9-12H2,1-6H3,(H,25,29)(H,27,28)/t23-/m0/s1 |
| InChIKey | NVHZEOLMCJUIID-QHCPKHFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| retezorogant (CHEBI:758665) is a 9,11,15-octadecatrienoic acid (CHEBI:38387) |
| INN | Source |
|---|---|
| retezorogant | WHO MedNet |