EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31ClN4O3 |
| Net Charge | 0 |
| Average Mass | 495.023 |
| Monoisotopic Mass | 494.20847 |
| SMILES | Cc1nc2c(c(C)c(C)n2Cc2cnn(C)c2)c(-c2ccc(Cl)cc2)c1[C@H](OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C27H31ClN4O3/c1-15-17(3)32(14-18-12-29-31(7)13-18)25-21(15)23(19-8-10-20(28)11-9-19)22(16(2)30-25)24(26(33)34)35-27(4,5)6/h8-13,24H,14H2,1-7H3,(H,33,34)/t24-/m0/s1 |
| InChIKey | GNRDGAWRAIJOSU-DEOSSOPVSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirmitegravir (CHEBI:758661) has role antiviral agent (CHEBI:22587) |
| pirmitegravir (CHEBI:758661) is a pyrrolopyridine (CHEBI:46771) |
| INN | Source |
|---|---|
| pirmitegravir | WHO MedNet |