EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22F2N6O2 |
| Net Charge | 0 |
| Average Mass | 440.454 |
| Monoisotopic Mass | 440.17723 |
| SMILES | O=C(O)[C@H]1C2CCC(CC2)[C@@H]1Nc1nc(-c2nnc3ncc(F)cc23)nc(C2CC2)c1F |
| InChI | InChI=1S/C22H22F2N6O2/c23-12-7-13-18(29-30-19(13)25-8-12)21-27-17(11-5-6-11)15(24)20(28-21)26-16-10-3-1-9(2-4-10)14(16)22(31)32/h7-11,14,16H,1-6H2,(H,31,32)(H,25,29,30)(H,26,27,28)/t9?,10?,14-,16-/m0/s1 |
| InChIKey | JCHDJLSIYWBAHI-ZWHBIUKWSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| onradivir (CHEBI:758659) has functional parent β-amino acid (CHEBI:33706) |
| onradivir (CHEBI:758659) has role antiviral agent (CHEBI:22587) |
| onradivir (CHEBI:758659) is a organonitrogen compound (CHEBI:35352) |
| onradivir (CHEBI:758659) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| onradivir | WHO MedNet |