EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23FN2O3 |
| Net Charge | 0 |
| Average Mass | 358.413 |
| Monoisotopic Mass | 358.16927 |
| SMILES | [H][C@@]12C[C@@H](Oc3ccccc3F)C[C@]1([H])CN(C[C@H](O)c1ccc(O)cn1)C2 |
| InChI | InChI=1S/C20H23FN2O3/c21-17-3-1-2-4-20(17)26-16-7-13-10-23(11-14(13)8-16)12-19(25)18-6-5-15(24)9-22-18/h1-6,9,13-14,16,19,24-25H,7-8,10-12H2/t13-,14+,16+,19-/m0/s1 |
| InChIKey | NEFQLCKWVRZEJA-ZDXGLAPJSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| onfasprodil (CHEBI:758658) has role antidepressant (CHEBI:35469) |
| onfasprodil (CHEBI:758658) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| onfasprodil | WHO MedNet |
| Synonyms | Source |
|---|---|
| CAD-9271 | ChEMBL |
| MIJ-821 | ChEMBL |
| MIJ821 | ChEMBL |
| MIJ821-NX | ChEMBL |
| NVP-MIJ821-NX | ChEMBL |