EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16F2N2 |
| Net Charge | 0 |
| Average Mass | 274.314 |
| Monoisotopic Mass | 274.12815 |
| SMILES | Fc1ccc(N(c2ccc(F)cc2)[C@H]2CCNC2)cc1 |
| InChI | InChI=1S/C16H16F2N2/c17-12-1-5-14(6-2-12)20(16-9-10-19-11-16)15-7-3-13(18)4-8-15/h1-8,16,19H,9-11H2/t16-/m0/s1 |
| InChIKey | ZKEVVJGPWXTETN-INIZCTEOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lafadofensine (CHEBI:758654) has role antidepressant (CHEBI:35469) |
| lafadofensine (CHEBI:758654) is a aromatic amine (CHEBI:33860) |
| lafadofensine (CHEBI:758654) is a tertiary amino compound (CHEBI:50996) |
| INNs | Source |
|---|---|
| lafadofensina | WHO MedNet |
| lafadofensine | WHO MedNet |