EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O |
| Net Charge | 0 |
| Average Mass | 296.454 |
| Monoisotopic Mass | 296.21402 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](C#C)CC[C@@]21[H] |
| InChI | InChI=1S/C21H28O/c1-4-14-6-8-18-17-7-5-15-13-16(22)9-11-21(15,3)19(17)10-12-20(14,18)2/h1,13-14,17-19H,5-12H2,2-3H3/t14-,17-,18-,19-,20+,21-/m0/s1 |
| InChIKey | CHOUAXDNNAVGHR-NWSAAYAGSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| itruvone (CHEBI:758653) has role androgen (CHEBI:50113) |
| itruvone (CHEBI:758653) has role antidepressant (CHEBI:35469) |
| itruvone (CHEBI:758653) has role dermatologic drug (CHEBI:50177) |
| itruvone (CHEBI:758653) is a 3-hydroxy steroid (CHEBI:36834) |
| INNs | Source |
|---|---|
| itruvona | WHO MedNet |
| itruvone | WHO MedNet |
| Synonyms | Source |
|---|---|
| BI PH10 | ChEMBL |
| Ph-10 | ChEMBL |
| PH10 | ChEMBL |