EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38ClN6O2P |
| Net Charge | 0 |
| Average Mass | 569.090 |
| Monoisotopic Mass | 568.24824 |
| SMILES | COc1cc(N2CCC3(CCN(C)CC3)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2P(C)(C)=O)n1 |
| InChI | InChI=1S/C29H38ClN6O2P/c1-35-15-11-29(12-16-35)13-17-36(18-14-29)21-9-10-23(25(19-21)38-2)33-28-31-20-22(30)27(34-28)32-24-7-5-6-8-26(24)39(3,4)37/h5-10,19-20H,11-18H2,1-4H3,(H2,31,32,33,34) |
| InChIKey | ZPCCNHQDFZCULN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iruplinalkib (CHEBI:758652) has role antineoplastic agent (CHEBI:35610) |
| iruplinalkib (CHEBI:758652) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| iruplinalkib | WHO MedNet |
| Citations |
|---|