EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23ClFN5O5S |
| Net Charge | 0 |
| Average Mass | 547.996 |
| Monoisotopic Mass | 547.10925 |
| SMILES | COc1ncc(-c2ccc3ncc(OCCN(C)C)c(=O)n3c2)cc1NS(=O)(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C24H23ClFN5O5S/c1-30(2)8-9-36-20-13-27-22-7-4-15(14-31(22)24(20)32)16-10-19(23(35-3)28-12-16)29-37(33,34)21-6-5-17(26)11-18(21)25/h4-7,10-14,29H,8-9H2,1-3H3 |
| InChIKey | BXKBZQAZYOZHJY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gilmelisib (CHEBI:758651) has role antineoplastic agent (CHEBI:35610) |
| gilmelisib (CHEBI:758651) is a bipyridines (CHEBI:50511) |
| INN | Source |
|---|---|
| gilmelisib | WHO MedNet |