EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H32F2N8O2 |
| Net Charge | 0 |
| Average Mass | 598.658 |
| Monoisotopic Mass | 598.26163 |
| SMILES | C=CC(=O)N1C[C@H](C)N(c2nc(=O)n(-c3c(C4CC4)ncnc3C3CC3)c3nc(-c4c(N)cccc4F)c(F)cc23)C[C@H]1C |
| InChI | InChI=1S/C32H32F2N8O2/c1-4-24(43)40-13-17(3)41(14-16(40)2)30-20-12-22(34)28(25-21(33)6-5-7-23(25)35)38-31(20)42(32(44)39-30)29-26(18-8-9-18)36-15-37-27(29)19-10-11-19/h4-7,12,15-19H,1,8-11,13-14,35H2,2-3H3/t16-,17+/m1/s1 |
| InChIKey | DKFRWZJCNPETGI-SJORKVTESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| garsorasib (CHEBI:758650) has role antineoplastic agent (CHEBI:35610) |
| garsorasib (CHEBI:758650) is a N-arylpiperazine (CHEBI:46848) |
| INN | Source |
|---|---|
| garsorasib | WHO MedNet |
| Synonym | Source |
|---|---|
| D 1553 | ChEMBL |