EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21FN6O3 |
| Net Charge | 0 |
| Average Mass | 424.436 |
| Monoisotopic Mass | 424.16592 |
| SMILES | [H][C@@]12CCC[C@]1([H])Oc1cn3ncc4c3nc1N2Cc1cc(F)cnc1O[C@@H](C)CNC4=O |
| InChI | InChI=1S/C21H21FN6O3/c1-11-6-23-20(29)14-8-25-28-10-17-19(26-18(14)28)27(15-3-2-4-16(15)31-17)9-12-5-13(22)7-24-21(12)30-11/h5,7-8,10-11,15-16H,2-4,6,9H2,1H3,(H,23,29)/t11-,15+,16-/m0/s1 |
| InChIKey | BYYQDEOVMILBQT-XZJROXQQSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enbezotinib (CHEBI:758647) has role antineoplastic agent (CHEBI:35610) |
| enbezotinib (CHEBI:758647) is a pyrazolopyrimidine (CHEBI:38669) |
| INN | Source |
|---|---|
| enbezotinib | WHO MedNet |
| Synonym | Source |
|---|---|
| TPX-0046 | ChEMBL |
| Citations |
|---|