EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H26F3NO2 |
| Net Charge | 0 |
| Average Mass | 477.526 |
| Monoisotopic Mass | 477.19156 |
| SMILES | CC1=C(c2cc(F)cc(F)c2)[C@H](c2ccc(/C=C/CN3CC(CF)C3)cc2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C29H26F3NO2/c1-18-26-9-8-25(34)14-27(26)35-29(28(18)22-11-23(31)13-24(32)12-22)21-6-4-19(5-7-21)3-2-10-33-16-20(15-30)17-33/h2-9,11-14,20,29,34H,10,15-17H2,1H3/b3-2+/t29-/m0/s1 |
| InChIKey | DVZLOPUYTKPWHJ-MPWQXXDYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bexirestrant (CHEBI:758642) has role antineoplastic agent (CHEBI:35610) |
| bexirestrant (CHEBI:758642) is a hydroxyflavonoid (CHEBI:71968) |
| INN | Source |
|---|---|
| bexirestrant | WHO MedNet |
| Citations |
|---|