EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28ClN5O5S2 |
| Net Charge | 0 |
| Average Mass | 578.116 |
| Monoisotopic Mass | 577.12204 |
| SMILES | Cc1sc(C(=O)c2cncnc2N[C@@H]2CC[C@H](COS(N)(=O)=O)[C@H]2O)cc1[C@@H]1NCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H28ClN5O5S2/c1-13-17(22-18-8-16(26)4-2-14(18)6-7-29-22)9-21(37-13)24(33)19-10-28-12-30-25(19)31-20-5-3-15(23(20)32)11-36-38(27,34)35/h2,4,8-10,12,15,20,22-23,29,32H,3,5-7,11H2,1H3,(H2,27,34,35)(H,28,30,31)/t15-,20-,22+,23-/m1/s1 |
| InChIKey | IAKPXYFFBURVCV-JWDANJKUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| subasumstat (CHEBI:758630) has role antineoplastic agent (CHEBI:35610) |
| subasumstat (CHEBI:758630) is a isoquinolines (CHEBI:24922) |
| INN | Source |
|---|---|
| subasumstat | WHO MedNet |
| Synonyms | Source |
|---|---|
| Sumoylation inhibitor tak-981 | ChEMBL |
| TAK-981 | ChEMBL |