EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23F6N7O3 |
| Net Charge | 0 |
| Average Mass | 523.438 |
| Monoisotopic Mass | 523.17666 |
| SMILES | C[C@@H](COCCC(=O)N1CCN(c2ncc(C(F)(F)F)cn2)CC1)Nc1cnnc(=O)c1C(F)(F)F |
| InChI | InChI=1S/C20H23F6N7O3/c1-12(30-14-10-29-31-17(35)16(14)20(24,25)26)11-36-7-2-15(34)32-3-5-33(6-4-32)18-27-8-13(9-28-18)19(21,22)23/h8-10,12H,2-7,11H2,1H3,(H2,30,31,35)/t12-/m0/s1 |
| InChIKey | UQZCQKXJAXKZQH-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atamparib (CHEBI:758629) has role antineoplastic agent (CHEBI:35610) |
| atamparib (CHEBI:758629) is a N-arylpiperazine (CHEBI:46848) |
| INN | Source |
|---|---|
| atamparib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Rbn 2397 | ChEMBL |
| RBN-2397 | ChEMBL |
| RBN2397 | ChEMBL |
| Citations |
|---|