EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:758628 - fasedienol
| Formula | C19H28O |
| Net Charge | 0 |
| Average Mass | 272.432 |
| Monoisotopic Mass | 272.21402 |
| SMILES | [H][C@@]12CCC3=C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C=CC[C@@]21[H] |
| InChI | InChI=1S/C19H28O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h3,9,12,14-17,20H,4-8,10-11H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | NYVFCEPOUVGTNP-DYKIIFRCSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fasedienol (CHEBI:758628) has role androgen (CHEBI:50113) |
| fasedienol (CHEBI:758628) has role anxiolytic drug (CHEBI:35474) |
| fasedienol (CHEBI:758628) is a 3-hydroxy steroid (CHEBI:36834) |
| INN | Source |
|---|---|
| fasedienol | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-androstadienol | ChEMBL |
| Aloradine | ChEMBL |
| Androsta-4,16-dien-3-ol, (3.beta.)- | ChEMBL |
| PH94B | ChEMBL |