EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H58N6O17.H3O |
| Net Charge | 0 |
| Average Mass | 1029.924 |
| Monoisotopic Mass | 1029.33221 |
| SMILES | O=C([O-])CN(CCN(CC(=O)[O-])Cc1cc(CCC(=O)NCCCCCC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)ccc1[O-])Cc1cc(CCC(=O)O)ccc1[O-].[68Ga+3].[OH3+] |
| InChI | InChI=1S/C44H62N6O17.Ga.H2O/c51-34-13-8-28(22-30(34)24-49(26-40(59)60)20-21-50(27-41(61)62)25-31-23-29(9-14-35(31)52)11-16-38(55)56)10-15-37(54)46-18-4-1-2-7-36(53)45-19-5-3-6-32(42(63)64)47-44(67)48-33(43(65)66)12-17-39(57)58;;/h8-9,13-14,22-23,32-33,51-52H,1-7,10-12,15-21,24-27H2,(H,45,53)(H,46,54)(H,55,56)(H,57,58)(H,59,60)(H,61,62)(H,63,64)(H,65,66)(H2,47,48,67);;1H2/q;+3;/p-3/t32-,33-;;/m0../s1/i;1-2; |
| InChIKey | ZSLQZWHCPBAGKD-RDIOTIBJSA-K |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gallium ga 68 gozetotide (CHEBI:758625) has functional parent pentacarboxylic acid (CHEBI:35743) |
| gallium ga 68 gozetotide (CHEBI:758625) has role antineoplastic agent (CHEBI:35610) |
| gallium ga 68 gozetotide (CHEBI:758625) has role radioactive imaging agent (CHEBI:37336) |
| gallium ga 68 gozetotide (CHEBI:758625) is a organooxygen compound (CHEBI:36963) |
| Synonyms | Source |
|---|---|
| (68ga)hbed-psma | ChEMBL |
| 68ga-psma-11 | ChEMBL |
| (68ga)psma-hbed-cc | ChEMBL |
| 68ga-psma-hbed-cc | ChEMBL |
| DKFZ-PSMA-11 GA-68 | ChEMBL |
| Ga-68-labeled psma-11 | ChEMBL |
| Brand Names | Source |
|---|---|
| Gallium ga 68 psma-11 | ChEMBL |
| Illuccix | ChEMBL |