EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H42F3N9O2S2 |
| Net Charge | 0 |
| Average Mass | 717.888 |
| Monoisotopic Mass | 717.28550 |
| SMILES | CNc1nc(NC2CCN(Cc3ccc4c(cc(C#N)n4C[C@H](C)N4CCN(S(C)(=O)=O)CC4)c3C)CC2)c2cc(CC(F)(F)F)sc2n1 |
| InChI | InChI=1S/C33H42F3N9O2S2/c1-21(43-11-13-44(14-12-43)49(4,46)47)19-45-25(18-37)15-27-22(2)23(5-6-29(27)45)20-42-9-7-24(8-10-42)39-30-28-16-26(17-33(34,35)36)48-31(28)41-32(38-3)40-30/h5-6,15-16,21,24H,7-14,17,19-20H2,1-4H3,(H2,38,39,40,41)/t21-/m0/s1 |
| InChIKey | BGGALFIXXQOTPY-NRFANRHFSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ziftomenib (CHEBI:758624) has role antineoplastic agent (CHEBI:35610) |
| ziftomenib (CHEBI:758624) is a indoles (CHEBI:24828) |
| INN | Source |
|---|---|
| ziftomenib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ko 539 | ChEMBL |
| KO-539 | ChEMBL |
| KO539 | ChEMBL |