EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H34N8O2 |
| Net Charge | 0 |
| Average Mass | 526.645 |
| Monoisotopic Mass | 526.28047 |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2n1-c1ccc2c(n1)[C@@](O)(CC)CC2 |
| InChI | InChI=1S/C29H34N8O2/c1-4-14-36-27(38)23-19-30-28(31-21-7-9-22(10-8-21)35-17-15-34(3)16-18-35)33-26(23)37(36)24-11-6-20-12-13-29(39,5-2)25(20)32-24/h4,6-11,19,39H,1,5,12-18H2,2-3H3,(H,30,31,33)/t29-/m1/s1 |
| InChIKey | OXTSYWDBUVRXFF-GDLZYMKVSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azenosertib (CHEBI:758622) has role antineoplastic agent (CHEBI:35610) |
| azenosertib (CHEBI:758622) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| azenosertib | WHO MedNet |
| Synonym | Source |
|---|---|
| ZN-C3 | ChEMBL |
| Citations |
|---|