EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H21N3O3 |
| Net Charge | 0 |
| Average Mass | 435.483 |
| Monoisotopic Mass | 435.15829 |
| SMILES | COc1ccc2c(Oc3ccc4c(C(=O)Nc5ccccc5N)cccc4c3)ccnc2c1 |
| InChI | InChI=1S/C27H21N3O3/c1-32-18-9-12-22-25(16-18)29-14-13-26(22)33-19-10-11-20-17(15-19)5-4-6-21(20)27(31)30-24-8-3-2-7-23(24)28/h2-16H,28H2,1H3,(H,30,31) |
| InChIKey | BRKWREZNORONDU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibcasertib (CHEBI:758619) has role antineoplastic agent (CHEBI:35610) |
| ibcasertib (CHEBI:758619) is a aromatic amide (CHEBI:62733) |
| ibcasertib (CHEBI:758619) is a naphthalenecarboxamide (CHEBI:48739) |
| INN | Source |
|---|---|
| ibcasertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Chiauranib | ChEMBL |
| CS-2164 | ChEMBL |
| CS2164 | ChEMBL |
| Citations |
|---|