EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C15H18N4O |
| Net Charge | 0 |
| Average Mass | 306.797 |
| Monoisotopic Mass | 306.12474 |
| SMILES | Cl.O=C(N[C@@H]1CN2CCC1CC2)c1nnc2ccccc12 |
| InChI | InChI=1S/C15H18N4O.ClH/c20-15(14-11-3-1-2-4-12(11)17-18-14)16-13-9-19-7-5-10(13)6-8-19;/h1-4,10,13H,5-9H2,(H,16,20)(H,17,18);1H/t13-;/m1./s1 |
| InChIKey | CMRLNEYJEPELSM-BTQNPOSSSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| facinicline hydrochloride (CHEBI:758618) has role antipsychotic agent (CHEBI:35476) |
| facinicline hydrochloride (CHEBI:758618) is a aromatic amide (CHEBI:62733) |
| facinicline hydrochloride (CHEBI:758618) is a indazoles (CHEBI:38769) |
| Synonyms | Source |
|---|---|
| Facinicline hydrochloride | ChEMBL |
| MEM 3454 | ChEMBL |
| MEM-3454 | ChEMBL |
| MEM3454 | ChEMBL |
| RG-3487 | ChEMBL |
| RG3487 | ChEMBL |