EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2O4S2 |
| Net Charge | 0 |
| Average Mass | 392.502 |
| Monoisotopic Mass | 392.08645 |
| SMILES | CC(C)S(=O)(=O)N[C@H]1COC[C@H]1Oc1ccc(-c2ccc(C#N)s2)cc1 |
| InChI | InChI=1S/C18H20N2O4S2/c1-12(2)26(21,22)20-16-10-23-11-17(16)24-14-5-3-13(4-6-14)18-8-7-15(9-19)25-18/h3-8,12,16-17,20H,10-11H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | TTYKUKSFWHEBLI-DLBZAZTESA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pesampator (CHEBI:758610) has role antipsychotic agent (CHEBI:35476) |
| pesampator (CHEBI:758610) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| pesampator | WHO MedNet |
| Synonyms | Source |
|---|---|
| BIIB-104 | ChEMBL |
| BIIB104 | ChEMBL |
| PF-04958242 | ChEMBL |
| PF-4958242 | ChEMBL |