EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26F3N6OP |
| Net Charge | 0 |
| Average Mass | 490.470 |
| Monoisotopic Mass | 490.18578 |
| SMILES | CC1(C)CC[C@H](Nc2ncc(C(F)(F)F)c(-c3cnc4c(P(C)(C)=O)c(C#N)ccc34)n2)CN1 |
| InChI | InChI=1S/C23H26F3N6OP/c1-22(2)8-7-14(10-30-22)31-21-29-12-17(23(24,25)26)18(32-21)16-11-28-19-15(16)6-5-13(9-27)20(19)34(3,4)33/h5-6,11-12,14,28,30H,7-8,10H2,1-4H3,(H,29,31,32)/t14-/m0/s1 |
| InChIKey | JDJOUBVVSQDIRC-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sy-5609 (CHEBI:758607) has role antineoplastic agent (CHEBI:35610) |
| sy-5609 (CHEBI:758607) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| Sy 5609 | ChEMBL |
| Sy-5609 | ChEMBL |
| SY5609 | ChEMBL |
| Citations |
|---|