EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:758601 - inaxaplin
| Formula | C21H18F3N3O3 |
| Net Charge | 0 |
| Average Mass | 417.387 |
| Monoisotopic Mass | 417.13003 |
| SMILES | O=C(CCc1c(-c2ccc(F)cc2)nc2c(F)cc(F)cc12)N[C@@H]1C(=O)NC[C@H]1O |
| InChI | InChI=1S/C21H18F3N3O3/c22-11-3-1-10(2-4-11)18-13(14-7-12(23)8-15(24)19(14)27-18)5-6-17(29)26-20-16(28)9-25-21(20)30/h1-4,7-8,16,20,27-28H,5-6,9H2,(H,25,30)(H,26,29)/t16-,20+/m1/s1 |
| InChIKey | CTXLPYZCBOVVQK-UZLBHIALSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inaxaplin (CHEBI:758601) has role renoprotective agent (CHEBI:231911) |
| inaxaplin (CHEBI:758601) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| Inaxaplin | ChEMBL |
| VX-147 | ChEMBL |
| VX147 | ChEMBL |