EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H28ClN7O |
| Net Charge | 0 |
| Average Mass | 526.044 |
| Monoisotopic Mass | 525.20439 |
| SMILES | C=CC(=O)N1CC2(CC(n3nc(-c4ccc5c(cnn5C)c4)c(-c4c(Cl)c(C)cc5nncc45)c3C)C2)C1 |
| InChI | InChI=1S/C29H28ClN7O/c1-5-24(38)36-14-29(15-36)10-20(11-29)37-17(3)25(26-21-13-31-33-22(21)8-16(2)27(26)30)28(34-37)18-6-7-23-19(9-18)12-32-35(23)4/h5-9,12-13,20H,1,10-11,14-15H2,2-4H3,(H,31,33) |
| InChIKey | AZUYLZMQTIKGSC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| opnurasib (CHEBI:758599) has role antineoplastic agent (CHEBI:35610) |
| opnurasib (CHEBI:758599) has role antiviral agent (CHEBI:22587) |
| opnurasib (CHEBI:758599) is a indazoles (CHEBI:38769) |
| INN | Source |
|---|---|
| opnurasib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Jdq 443 | ChEMBL |
| Jdq-443 | ChEMBL |
| JDQ443 | ChEMBL |
| Nvp-jdq-443 | ChEMBL |
| Citations |
|---|