EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23ClN4O6 |
| Net Charge | 0 |
| Average Mass | 498.923 |
| Monoisotopic Mass | 498.13061 |
| SMILES | CCOCc1nc(O)c(-c2nnc(Cc3ccc(Cl)cn3)o2)c(O)c1-c1c(OC)cccc1OC |
| InChI | InChI=1S/C24H23ClN4O6/c1-4-34-12-15-19(20-16(32-2)6-5-7-17(20)33-3)22(30)21(23(31)27-15)24-29-28-18(35-24)10-14-9-8-13(25)11-26-14/h5-9,11H,4,10,12H2,1-3H3,(H2,27,30,31) |
| InChIKey | AGZKELPIAJYRDT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-986224 (CHEBI:758594) has role cardiovascular drug (CHEBI:35554) |
| bms-986224 (CHEBI:758594) is a dimethoxybenzene (CHEBI:51681) |
| Synonym | Source |
|---|---|
| Bms-986224 | ChEMBL |
| Citations |
|---|