EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19ClF3N5O |
| Net Charge | 0 |
| Average Mass | 449.864 |
| Monoisotopic Mass | 449.12302 |
| SMILES | NC(=O)c1cccc2c(N[C@H](CN3CCC3)c3ccc(Cl)c(C(F)(F)F)c3)ncnc12 |
| InChI | InChI=1S/C21H19ClF3N5O/c22-16-6-5-12(9-15(16)21(23,24)25)17(10-30-7-2-8-30)29-20-14-4-1-3-13(19(26)31)18(14)27-11-28-20/h1,3-6,9,11,17H,2,7-8,10H2,(H2,26,31)(H,27,28,29)/t17-/m1/s1 |
| InChIKey | HXAUJHZZPCBFPN-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rupitasertib (CHEBI:758593) has role antineoplastic agent (CHEBI:35610) |
| rupitasertib (CHEBI:758593) is a quinazolines (CHEBI:38530) |
| INN | Source |
|---|---|
| rupitasertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| M-2698 | ChEMBL |
| M2698 | ChEMBL |
| MSC-2363318A | ChEMBL |
| MSC2363318A | ChEMBL |
| Citations |
|---|