EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22F3N5O4 |
| Net Charge | 0 |
| Average Mass | 465.432 |
| Monoisotopic Mass | 465.16239 |
| SMILES | CCOC(=O)C1=C(NN2CCN(CC(F)(F)F)CC2)O/C(=C\c2cnc3ncccc23)C1=O |
| InChI | InChI=1S/C21H22F3N5O4/c1-2-32-20(31)16-17(30)15(10-13-11-26-18-14(13)4-3-5-25-18)33-19(16)27-29-8-6-28(7-9-29)12-21(22,23)24/h3-5,10-11,27H,2,6-9,12H2,1H3,(H,25,26)/b15-10- |
| InChIKey | DNTVXDZWVOVLOD-GDNBJRDFSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monzosertib (CHEBI:758592) has role antineoplastic agent (CHEBI:35610) |
| monzosertib (CHEBI:758592) is a pyrrolopyridine (CHEBI:46771) |
| INN | Source |
|---|---|
| monzosertib | WHO MedNet |
| Citations |
|---|