EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:758590 - bavdegalutamide
| Formula | C41H43ClFN9O6 |
| Net Charge | 0 |
| Average Mass | 812.303 |
| Monoisotopic Mass | 811.30089 |
| SMILES | N#Cc1ccc(O[C@H]2CC[C@H](NC(=O)c3ccc(N4CCC(CN5CCN(c6cc7c(cc6F)C(=O)N(C6CCC(=O)NC6=O)C7=O)CC5)CC4)nn3)CC2)cc1Cl |
| InChI | InChI=1S/C41H43ClFN9O6/c42-31-19-28(4-1-25(31)22-44)58-27-5-2-26(3-6-27)45-38(54)33-7-9-36(48-47-33)51-13-11-24(12-14-51)23-49-15-17-50(18-16-49)35-21-30-29(20-32(35)43)40(56)52(41(30)57)34-8-10-37(53)46-39(34)55/h1,4,7,9,19-21,24,26-27,34H,2-3,5-6,8,10-18,23H2,(H,45,54)(H,46,53,55)/t26-,27-,34? |
| InChIKey | CLCTZVRHDOAUGJ-SYVGMNBRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bavdegalutamide (CHEBI:758590) has role antineoplastic agent (CHEBI:35610) |
| bavdegalutamide (CHEBI:758590) is a N-arylpiperazine (CHEBI:46848) |
| INN | Source |
|---|---|
| bavdegalutamide | WHO MedNet |
| Synonyms | Source |
|---|---|
| ARV-110 | ChEMBL |
| ARV110 | ChEMBL |
| ARV-110 (PROTAC) | ChEMBL |
| Citations |
|---|