EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N6O3 |
| Net Charge | 0 |
| Average Mass | 378.392 |
| Monoisotopic Mass | 378.14404 |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2nnc(Cc3ccccc3)n2)COc2cccnc21 |
| InChI | InChI=1S/C19H18N6O3/c1-25-17-14(8-5-9-20-17)28-11-13(19(25)27)21-18(26)16-22-15(23-24-16)10-12-6-3-2-4-7-12/h2-9,13H,10-11H2,1H3,(H,21,26)(H,22,23,24)/t13-/m0/s1 |
| InChIKey | XUZICJHIIJCKQQ-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eclitasertib (CHEBI:758589) has role anti-inflammatory agent (CHEBI:67079) |
| eclitasertib (CHEBI:758589) has role anticoronaviral agent (CHEBI:149553) |
| eclitasertib (CHEBI:758589) has role antiviral agent (CHEBI:22587) |
| eclitasertib (CHEBI:758589) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| DNL-758 | ChEMBL |
| DNL758 | ChEMBL |
| Eclitasertib | ChEMBL |
| SAR-443122 | ChEMBL |
| SAR443122 | ChEMBL |
| Citations |
|---|