EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27N5O2 |
| Net Charge | 0 |
| Average Mass | 321.425 |
| Monoisotopic Mass | 321.21648 |
| SMILES | C[C@@H]1CC[C@@H](Nc2nc(NC(C)(C)C)ncc2C(N)=O)C[C@H]1O |
| InChI | InChI=1S/C16H27N5O2/c1-9-5-6-10(7-12(9)22)19-14-11(13(17)23)8-18-15(20-14)21-16(2,3)4/h8-10,12,22H,5-7H2,1-4H3,(H2,17,23)(H2,18,19,20,21)/t9-,10-,12-/m1/s1 |
| InChIKey | QBBRJRLJWXRSHQ-CKYFFXLPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cc-90001 (CHEBI:758583) has role antifibrotic agent (CHEBI:233423) |
| cc-90001 (CHEBI:758583) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| Synonyms | Source |
|---|---|
| Cc-90001 | ChEMBL |
| CC90001 | ChEMBL |
| Citations |
|---|