EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H54N4O6 |
| Net Charge | 0 |
| Average Mass | 710.916 |
| Monoisotopic Mass | 710.40434 |
| SMILES | [H][C@]1([C@H](Cc2cccc(CN(Cc3cccc(C[C@H](C(=O)O)[C@@]4([H])CCNC4)c3)Cc3cccc(C[C@H](C(=O)O)[C@@]4([H])CCNC4)c3)c2)C(=O)O)CCNC1 |
| InChI | InChI=1S/C42H54N4O6/c47-40(48)37(34-10-13-43-22-34)19-28-4-1-7-31(16-28)25-46(26-32-8-2-5-29(17-32)20-38(41(49)50)35-11-14-44-23-35)27-33-9-3-6-30(18-33)21-39(42(51)52)36-12-15-45-24-36/h1-9,16-18,34-39,43-45H,10-15,19-27H2,(H,47,48)(H,49,50)(H,51,52)/t34-,35-,36-,37-,38-,39-/m0/s1 |
| InChIKey | BRLGERLDHZRETI-BGBFCPIGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| muvalaplin (CHEBI:758579) has role cardiovascular drug (CHEBI:35554) |
| muvalaplin (CHEBI:758579) is a benzenes (CHEBI:22712) |
| muvalaplin (CHEBI:758579) is a monocarboxylic acid (CHEBI:25384) |
| INNs | Source |
|---|---|
| muvalaplin | WHO MedNet |
| muvalaplina | WHO MedNet |
| muvalapline | WHO MedNet |
| Synonyms | Source |
|---|---|
| LY-3473329 | ChEMBL |
| LY3473329 | ChEMBL |