EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40N7O19P3S |
| Net Charge | 0 |
| Average Mass | 879.625 |
| Monoisotopic Mass | 879.13125 |
| SMILES | C/C(=C\C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C26H40N7O19P3S/c1-13(25(39)40)8-16(35)56-7-6-28-15(34)4-5-29-23(38)20(37)26(2,3)10-49-55(46,47)52-54(44,45)48-9-14-19(51-53(41,42)43)18(36)24(50-14)33-12-32-17-21(27)30-11-31-22(17)33/h8,11-12,14,18-20,24,36-37H,4-7,9-10H2,1-3H3,(H,28,34)(H,29,38)(H,39,40)(H,44,45)(H,46,47)(H2,27,30,31)(H2,41,42,43)/b13-8+/t14-,18-,19-,20+,24-/m1/s1 |
| InChIKey | UQKJYLOHHMRSFE-CBBDEUQJSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylfumaryl-CoA (CHEBI:75856) has functional parent mesaconic acid (CHEBI:16600) |
| 3-methylfumaryl-CoA (CHEBI:75856) is a ω-carboxyacyl-CoA (CHEBI:37555) |
| 3-methylfumaryl-CoA (CHEBI:75856) is conjugate acid of 3-methylfumaryl-CoA(5−) (CHEBI:75636) |
| Incoming Relation(s) |
| 3-methylfumaryl-CoA(5−) (CHEBI:75636) is conjugate base of 3-methylfumaryl-CoA (CHEBI:75856) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-({3-[(2-{[(2E)-3-carboxy-3-methylprop-2-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 3-methylfumaryl-coenzyme A | ChEBI |
| Mesaconyl-C4-CoA | KEGG COMPOUND |
| Citations |
|---|