EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C13H18N4O8 |
| Net Charge | 0 |
| Average Mass | 394.768 |
| Monoisotopic Mass | 394.08914 |
| SMILES | Cl.N[C@@H](CC(=O)Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n1)C(=O)O |
| InChI | InChI=1S/C13H18N4O8.ClH/c14-5(12(22)23)3-8(19)15-7-1-2-17(13(24)16-7)11-10(21)9(20)6(4-18)25-11;/h1-2,5-6,9-11,18,20-21H,3-4,14H2,(H,22,23)(H,15,16,19,24);1H/t5-,6+,9+,10-,11+;/m0./s1 |
| InChIKey | YEMILTFWPDSGPU-HIUGLTFESA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspacytarabine hydrochloride (CHEBI:758557) has role antineoplastic agent (CHEBI:35610) |
| aspacytarabine hydrochloride (CHEBI:758557) is a pyrimidine nucleoside (CHEBI:26440) |
| Synonyms | Source |
|---|---|
| Aspacytarabine hydrochloride | ChEMBL |
| BST-236 HCl | ChEMBL |