EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:758556 - lenacapavir sodium
| Formula | Na.C39H31ClF10N7O5S2 |
| Net Charge | 0 |
| Average Mass | 990.278 |
| Monoisotopic Mass | 989.12546 |
| SMILES | [H][C@@]12C[C@]1([H])c1c(C(F)(F)F)nn(CC(=O)N[C@@H](Cc3cc(F)cc(F)c3)c3nc(C#CC(C)(C)S(C)(=O)=O)ccc3-c3ccc(Cl)c4c([N-]S(C)(=O)=O)nn(CC(F)(F)F)c34)c1C2(F)F.[Na+] |
| InChI | InChI=1S/C39H32ClF10N7O5S2.Na/c1-36(2,63(3,59)60)10-9-21-5-6-22(23-7-8-26(40)30-32(23)57(17-37(43,44)45)54-35(30)55-64(4,61)62)31(51-21)27(13-18-11-19(41)14-20(42)12-18)52-28(58)16-56-34-29(33(53-56)39(48,49)50)24-15-25(24)38(34,46)47;/h5-8,11-12,14,24-25,27H,13,15-17H2,1-4H3,(H2,52,54,55,58);/q;+1/p-1/t24-,25+,27-;/m0./s1 |
| InChIKey | SSXPGMNGIORJAQ-PZNXWHLTSA-M |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lenacapavir sodium (CHEBI:758556) has role anti-HIV agent (CHEBI:64946) |
| lenacapavir sodium (CHEBI:758556) has role anti-HIV-1 agent (CHEBI:64947) |
| lenacapavir sodium (CHEBI:758556) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| GS-6207-02 | ChEMBL |
| GS-HIV Na | ChEMBL |
| GS-HIV SODIUM | ChEMBL |
| Lenacapavir sodium | ChEMBL |