EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C27H45O5S |
| Net Charge | 0 |
| Average Mass | 504.709 |
| Monoisotopic Mass | 504.28854 |
| SMILES | [H][C@@]12CC=C3C[C@@H](OS(=O)(=O)[O-])CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCCC(C)(C)O.[Na+] |
| InChI | InChI=1S/C27H46O5S.Na/c1-18(7-6-14-25(2,3)28)22-10-11-23-21-9-8-19-17-20(32-33(29,30)31)12-15-26(19,4)24(21)13-16-27(22,23)5;/h8,18,20-24,28H,6-7,9-17H2,1-5H3,(H,29,30,31);/q;+1/p-1/t18-,20+,21+,22-,23+,24+,26+,27-;/m1./s1 |
| InChIKey | OEGAOHNRCSZIRO-KSGNISEOSA-M |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| larsucosterol sodium (CHEBI:758553) has role anticoronaviral agent (CHEBI:149553) |
| larsucosterol sodium (CHEBI:758553) is a cholestanoid (CHEBI:50401) |
| Synonyms | Source |
|---|---|
| DUR-928 sodium | ChEMBL |
| DV-928 SODIUM | ChEMBL |
| Larsucosterol sodium | ChEMBL |
| Sodium larsucosterol | ChEMBL |