EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3O4P.C36H45F4N3O5 |
| Net Charge | 0 |
| Average Mass | 773.758 |
| Monoisotopic Mass | 773.30643 |
| SMILES | COC[C@H]1CN(C(=O)[C@]2(F)CN(C3CCCC3)C[C@H]2c2ccc(OC)cc2)C[C@@H]1c1ccc(C(F)(F)F)cc1N1CCC(C(=O)O)CC1.O=P(O)(O)O |
| InChI | InChI=1S/C36H45F4N3O5.H3O4P/c1-47-21-25-18-42(19-30(25)29-12-9-26(36(38,39)40)17-32(29)41-15-13-24(14-16-41)33(44)45)34(46)35(37)22-43(27-5-3-4-6-27)20-31(35)23-7-10-28(48-2)11-8-23;1-5(2,3)4/h7-12,17,24-25,27,30-31H,3-6,13-16,18-22H2,1-2H3,(H,44,45);(H3,1,2,3,4)/t25-,30+,31+,35+;/m1./s1 |
| InChIKey | PICGAOGKGDTMCU-ZPNFXMDPSA-N |
| Roles Classification |
|---|
| Application: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dersimelagon phosphate (CHEBI:758551) has role dermatologic drug (CHEBI:50177) |
| dersimelagon phosphate (CHEBI:758551) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| Dersimelagon phosphate | ChEMBL |
| Dersimelagon phosphoric acid | ChEMBL |
| MT-7117 phosphate | ChEMBL |