EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.C22H27N7O2S |
| Net Charge | 0 |
| Average Mass | 549.679 |
| Monoisotopic Mass | 549.18281 |
| SMILES | CS(=O)(=O)O.Cn1nccc1Nc1nccc(-c2cc3c(s2)C(C)(C)N(CCN2CCOCC2)C3=O)n1 |
| InChI | InChI=1S/C22H27N7O2S.CH4O3S/c1-22(2)19-15(20(30)29(22)9-8-28-10-12-31-13-11-28)14-17(32-19)16-4-6-23-21(25-16)26-18-5-7-24-27(18)3;1-5(2,3)4/h4-7,14H,8-13H2,1-3H3,(H,23,25,26);1H3,(H,2,3,4) |
| InChIKey | FAAFOFKUNKWPID-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| temuterkib mesylate (CHEBI:758550) has role antineoplastic agent (CHEBI:35610) |
| temuterkib mesylate (CHEBI:758550) is a thiophenes (CHEBI:26961) |
| Synonyms | Source |
|---|---|
| LY-3214996 MESYLATE | ChEMBL |
| LY-3518429 | ChEMBL |
| LY3518429 | ChEMBL |
| Temuterkib mesylate | ChEMBL |