EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N3O12P3S |
| Net Charge | 0 |
| Average Mass | 469.198 |
| Monoisotopic Mass | 468.95110 |
| SMILES | Nc1ccn([C@H]2CO[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)S2)c(=O)n1 |
| InChI | InChI=1S/C8H14N3O12P3S/c9-5-1-2-11(8(12)10-5)6-3-20-7(27-6)4-21-25(16,17)23-26(18,19)22-24(13,14)15/h1-2,6-7H,3-4H2,(H,16,17)(H,18,19)(H2,9,10,12)(H2,13,14,15)/t6-,7-/m1/s1 |
| InChIKey | BGYHXXSVOYUZOJ-RNFRBKRXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apricitabine triphosphate (CHEBI:758537) is a 9,11,15-octadecatrienoic acid (CHEBI:38387) |
| Synonym | Source |
|---|---|
| Apricitabine triphosphate | ChEMBL |