EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33N4O9P |
| Net Charge | 0 |
| Average Mass | 552.521 |
| Monoisotopic Mass | 552.19852 |
| SMILES | COc1cccc2nc(C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C[C@@H]3CCNC3=O)C(=O)COP(=O)(O)O)cc12 |
| InChI | InChI=1S/C24H33N4O9P/c1-13(2)9-18(28-24(32)19-11-15-16(26-19)5-4-6-21(15)36-3)23(31)27-17(10-14-7-8-25-22(14)30)20(29)12-37-38(33,34)35/h4-6,11,13-14,17-18,26H,7-10,12H2,1-3H3,(H,25,30)(H,27,31)(H,28,32)(H2,33,34,35)/t14-,17-,18-/m0/s1 |
| InChIKey | FQKALOFOWPDTED-WBAXXEDZSA-N |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lufotrelvir (CHEBI:758525) has role anticoronaviral agent (CHEBI:149553) |
| lufotrelvir (CHEBI:758525) has role antiviral agent (CHEBI:22587) |
| lufotrelvir (CHEBI:758525) is a leucine derivative (CHEBI:47003) |
| INN | Source |
|---|---|
| lufotrelvir | WHO MedNet |
| Synonym | Source |
|---|---|
| PF-07304814 | ChEMBL |
| Citations |
|---|