EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H37N7O2 |
| Net Charge | 0 |
| Average Mass | 527.673 |
| Monoisotopic Mass | 527.30087 |
| SMILES | CCc1cc(O)ccc1-c1ccc2c(-c3nc4c(n3)CN(C(C)C)[C@H](C(=O)N3CC(N(C)C)C3)C4)nnc2c1 |
| InChI | InChI=1S/C30H37N7O2/c1-6-18-11-21(38)8-10-22(18)19-7-9-23-24(12-19)33-34-28(23)29-31-25-13-27(37(17(2)3)16-26(25)32-29)30(39)36-14-20(15-36)35(4)5/h7-12,17,20,27,38H,6,13-16H2,1-5H3,(H,31,32)(H,33,34)/t27-/m0/s1 |
| InChIKey | VQIIUJSNIKEMCK-MHZLTWQESA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nezulcitinib (CHEBI:758484) has role anticoronaviral agent (CHEBI:149553) |
| nezulcitinib (CHEBI:758484) has role antiviral agent (CHEBI:22587) |
| nezulcitinib (CHEBI:758484) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| nezulcitinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| TD-0903 | ChEMBL |
| THRX-136377 | ChEMBL |