EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15F3N4 |
| Net Charge | 0 |
| Average Mass | 320.318 |
| Monoisotopic Mass | 320.12488 |
| SMILES | N#Cc1ccc(N2C[C@H](N)C[C@H](C(F)(F)F)C2)c2cccnc12 |
| InChI | InChI=1S/C16H15F3N4/c17-16(18,19)11-6-12(21)9-23(8-11)14-4-3-10(7-20)15-13(14)2-1-5-22-15/h1-5,11-12H,6,8-9,21H2/t11-,12+/m0/s1 |
| InChIKey | BJXYHBKEQFQVES-NWDGAFQWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enpatoran (CHEBI:758481) has role anticoronaviral agent (CHEBI:149553) |
| enpatoran (CHEBI:758481) has role antiviral agent (CHEBI:22587) |
| enpatoran (CHEBI:758481) is a aminoquinoline (CHEBI:36709) |
| INN | Source |
|---|---|
| enpatoran | WHO MedNet |
| Synonyms | Source |
|---|---|
| M-5049 | ChEMBL |
| M5049 | ChEMBL |