EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O5S |
| Net Charge | 0 |
| Average Mass | 482.727 |
| Monoisotopic Mass | 482.30660 |
| SMILES | [H][C@@]12CC=C3C[C@@H](OS(=O)(=O)O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCCC(C)(C)O |
| InChI | InChI=1S/C27H46O5S/c1-18(7-6-14-25(2,3)28)22-10-11-23-21-9-8-19-17-20(32-33(29,30)31)12-15-26(19,4)24(21)13-16-27(22,23)5/h8,18,20-24,28H,6-7,9-17H2,1-5H3,(H,29,30,31)/t18-,20+,21+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | PIUZYOCNZPYXOA-ZHHJOTBYSA-N |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| larsucosterol (CHEBI:758480) has role anticoronaviral agent (CHEBI:149553) |
| larsucosterol (CHEBI:758480) has role antipsoriatic (CHEBI:50748) |
| larsucosterol (CHEBI:758480) has role antiviral agent (CHEBI:22587) |
| larsucosterol (CHEBI:758480) is a cholestanoid (CHEBI:50401) |
| INN | Source |
|---|---|
| larsucosterol | WHO MedNet |
| Synonyms | Source |
|---|---|
| 25HC3S | ChEMBL |
| Dur 928 | ChEMBL |
| DUR-928 | ChEMBL |
| DUR928 | ChEMBL |
| DV-928 | ChEMBL |