EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H38N8O |
| Net Charge | 0 |
| Average Mass | 586.744 |
| Monoisotopic Mass | 586.31686 |
| SMILES | CC(=O)N(C)C1CCN(c2cccc(-c3ccc4nc(-c5cccnc5N)n(-c5ccc(C6(N)CCC6)cc5)c4n3)c2)CC1 |
| InChI | InChI=1S/C35H38N8O/c1-23(44)41(2)26-15-20-42(21-16-26)28-7-3-6-24(22-28)30-13-14-31-34(39-30)43(33(40-31)29-8-4-19-38-32(29)36)27-11-9-25(10-12-27)35(37)17-5-18-35/h3-4,6-14,19,22,26H,5,15-18,20-21,37H2,1-2H3,(H2,36,38) |
| InChIKey | NZDSLYATTDIDPH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vevorisertib (CHEBI:758478) has role antineoplastic agent (CHEBI:35610) |
| vevorisertib (CHEBI:758478) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| vevorisertib | WHO MedNet |
| Citations |
|---|