EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:758474 - senaparib
| Formula | C24H20F2N6O3 |
| Net Charge | 0 |
| Average Mass | 478.459 |
| Monoisotopic Mass | 478.15649 |
| SMILES | O=C(c1cc(Cn2c(=O)nc(=O)c3c(F)cccc32)ccc1F)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C24H20F2N6O3/c25-17-6-5-15(14-32-19-4-1-3-18(26)20(19)21(33)29-24(32)35)13-16(17)22(34)30-9-11-31(12-10-30)23-27-7-2-8-28-23/h1-8,13H,9-12,14H2,(H,29,33,35) |
| InChIKey | VBTUJTGLLREMNW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| senaparib (CHEBI:758474) has role antineoplastic agent (CHEBI:35610) |
| senaparib (CHEBI:758474) is a N-arylpiperazine (CHEBI:46848) |
| INN | Source |
|---|---|
| senaparib | WHO MedNet |
| Synonyms | Source |
|---|---|
| IMP-4297 | ChEMBL |
| IMP4297 | ChEMBL |