EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C57H66ClF4N6O11PS4 |
| Net Charge | 0 |
| Average Mass | 1281.873 |
| Monoisotopic Mass | 1280.30347 |
| SMILES | Cc1c(S(C)(=O)=O)c(-c2cc(F)cc(N3CCN(c4ccc(NS(=O)(=O)c5ccc(N[C@H](CCN6CCC(C(=O)OCCCP(=O)(O)O)CC6)CSc6ccccc6)c(S(=O)(=O)C(F)(F)F)c5)cc4)CC3)c2)c(-c2ccc(Cl)cc2)n1C(C)C |
| InChI | InChI=1S/C57H66ClF4N6O11PS4/c1-38(2)68-39(3)55(82(4,73)74)53(54(68)40-11-13-43(58)14-12-40)42-33-44(59)35-48(34-42)67-29-27-66(28-30-67)47-17-15-45(16-18-47)64-84(77,78)50-19-20-51(52(36-50)83(75,76)57(60,61)62)63-46(37-81-49-9-6-5-7-10-49)23-26-65-24-21-41(22-25-65)56(69)79-31-8-32-80(70,71)72/h5-7,9-20,33-36,38,41,46,63-64H,8,21-32,37H2,1-4H3,(H2,70,71,72)/t46-/m1/s1 |
| InChIKey | QIOCQCYXBYUYLH-YACUFSJGSA-N |
| Roles Classification |
|---|
| Applications: | antifibrotic agent Any agent which acts to reduce fibrosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pelcitoclax (CHEBI:758473) has role antifibrotic agent (CHEBI:233423) |
| pelcitoclax (CHEBI:758473) has role antineoplastic agent (CHEBI:35610) |
| pelcitoclax (CHEBI:758473) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| pelcitoclax | WHO MedNet |
| Synonyms | Source |
|---|---|
| Apg-1252 | ChEMBL |
| APG1252 | ChEMBL |
| Citations |
|---|