EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20NO6P |
| Net Charge | 0 |
| Average Mass | 317.278 |
| Monoisotopic Mass | 317.10282 |
| SMILES | Cc1cc(C2CCCCC2)n(OCOP(=O)(O)O)c(=O)c1 |
| InChI | InChI=1S/C13H20NO6P/c1-10-7-12(11-5-3-2-4-6-11)14(13(15)8-10)19-9-20-21(16,17)18/h7-8,11H,2-6,9H2,1H3,(H2,16,17,18) |
| InChIKey | NTKBXPWLNROYPE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosciclopirox (CHEBI:758471) has role antineoplastic agent (CHEBI:35610) |
| fosciclopirox (CHEBI:758471) is a chloropyridine (CHEBI:39173) |
| INN | Source |
|---|---|
| fosciclopirox | WHO MedNet |
| Synonym | Source |
|---|---|
| Ciclopirox-pom | ChEMBL |