EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H102O6 |
| Net Charge | 0 |
| Average Mass | 859.415 |
| Monoisotopic Mass | 858.76764 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C55H102O6/c1-4-7-10-13-16-19-22-25-27-30-33-36-39-42-45-48-54(57)60-51-52(50-59-53(56)47-44-41-38-35-32-29-24-21-18-15-12-9-6-3)61-55(58)49-46-43-40-37-34-31-28-26-23-20-17-14-11-8-5-2/h25-28,52H,4-24,29-51H2,1-3H3/b27-25-,28-26-/t52-/m1/s1 |
| InChIKey | JFISYPWOVQNHLS-VJYDLUETSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-palmitoyl-2,3-dioleoyl-sn-glycerol (CHEBI:75847) has role mouse metabolite (CHEBI:75771) |
| 1-palmitoyl-2,3-dioleoyl-sn-glycerol (CHEBI:75847) is a 1,2-dioleoyl-3-palmitoylglycerol (CHEBI:75848) |
| 1-palmitoyl-2,3-dioleoyl-sn-glycerol (CHEBI:75847) is a triacyl-sn-glycerol (CHEBI:64615) |
| 1-palmitoyl-2,3-dioleoyl-sn-glycerol (CHEBI:75847) is enantiomer of 1,2-dioleoyl-3-palmitoyl-sn-glycerol (CHEBI:75583) |
| Incoming Relation(s) |
| rac-1,2-dioleoyl-3-palmitoylglycerol (CHEBI:75941) has part 1-palmitoyl-2,3-dioleoyl-sn-glycerol (CHEBI:75847) |
| 1,2-dioleoyl-3-palmitoyl-sn-glycerol (CHEBI:75583) is enantiomer of 1-palmitoyl-2,3-dioleoyl-sn-glycerol (CHEBI:75847) |
| IUPAC Name |
|---|
| (2R)-3-(hexadecanoyloxy)propane-1,2-diyl (9Z,9'Z)bis-octadec-9-enoate |
| Synonyms | Source |
|---|---|
| 1-hexadecanoyl-2,3-di-(9Z-octadecenoyl)-sn-glycerol | LIPID MAPS |
| TG(16:0/18:1/18:1)[iso3] | LIPID MAPS |
| TG(16:0/18:1(9Z)/18:1(9Z))[iso3] | LIPID MAPS |
| TG[16:0/18:1(ω-9)/18:1(ω-9)] | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 1-hexadecanoyl-2,3-di-(9Z)-octadecenoyl-sn-glycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMGL03010100 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2069064 | Reaxys |