EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O2 |
| Net Charge | 0 |
| Average Mass | 194.234 |
| Monoisotopic Mass | 194.10553 |
| SMILES | C=CC[C@@]12CCCN1C(=O)CNC2=O |
| InChI | InChI=1S/C10H14N2O2/c1-2-4-10-5-3-6-12(10)8(13)7-11-9(10)14/h2H,1,3-7H2,(H,11,14)/t10-/m0/s1 |
| InChIKey | WVKCGUOWPZAROG-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nnz-2591 (CHEBI:758466) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Cyclo(-l-glycyl-l-2-allylproline) | ChEMBL |
| Nnz-2591 | ChEMBL |