EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N3O14P3 |
| Net Charge | 0 |
| Average Mass | 511.210 |
| Monoisotopic Mass | 511.01581 |
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H20N3O14P3/c1-11(18,29(19,20)21)30(22,23)28-31(24,25)26-4-5-7(15)8(16)9(27-5)14-3-2-6(12)13-10(14)17/h2-3,5,7-9,15-16,18H,4H2,1H3,(H,22,23)(H,24,25)(H2,12,13,17)(H2,19,20,21)/t5-,7-,8+,9-,11?/m1/s1 |
| InChIKey | HUIKCRXUQCSUJS-ZLRZYOKSSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mbc-11 (CHEBI:758465) has role antineoplastic agent (CHEBI:35610) |
| mbc-11 (CHEBI:758465) is a phospho sugar (CHEBI:33447) |
| Synonym | Source |
|---|---|
| Mbc-11 | ChEMBL |