EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H27N5O6 |
| Net Charge | 0 |
| Average Mass | 373.410 |
| Monoisotopic Mass | 373.19613 |
| SMILES | CC(C)[C@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)N)C(=O)O |
| InChI | InChI=1S/C15H27N5O6/c1-7(2)12(15(25)26)20-11(22)6-18-14(24)9(4-5-10(17)21)19-13(23)8(3)16/h7-9,12H,4-6,16H2,1-3H3,(H2,17,21)(H,18,24)(H,19,23)(H,20,22)(H,25,26)/t8-,9-,12-/m0/s1 |
| InChIKey | DXRXYJYFADHAPA-AUTRQRHGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ea-230 (CHEBI:758464) has role anti-inflammatory agent (CHEBI:67079) |
| ea-230 (CHEBI:758464) is a polypeptide (CHEBI:15841) |
| Synonyms | Source |
|---|---|
| Ea-230 | ChEMBL |
| Nmpf-46 | ChEMBL |