EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25O5P |
| Net Charge | 0 |
| Average Mass | 412.422 |
| Monoisotopic Mass | 412.14396 |
| SMILES | Cc1cc(OCP(=O)(O)O)cc(C)c1Cc1ccc(O)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H25O5P/c1-16-10-21(28-15-29(25,26)27)11-17(2)22(16)14-19-8-9-23(24)20(13-19)12-18-6-4-3-5-7-18/h3-11,13,24H,12,14-15H2,1-2H3,(H2,25,26,27) |
| InChIKey | GFJCILQBXUTOGN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vk-0214 (CHEBI:758461) is a diarylheptanoid (CHEBI:78802) |
| Synonyms | Source |
|---|---|
| VK-0214 | ChEMBL |
| VK0214 | ChEMBL |